C24H18FNO6 — CID 2357934
2-[3-(4-fluorophenoxy)-4-oxochromen-7-yl]oxy-N-(4-methoxyphenyl)acetamide (PubChem CID 2357934) has the molecular formula C24H18FNO6 and a molecular weight of 435.41 g/mol. Its IUPAC name is 2-[3-(4-fluorophenoxy)-4-oxochromen-7-yl]oxy-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[3-(4-fluorophenoxy)-4-oxochromen-7-yl]oxy-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2357934 |
| Molecular Formula | C24H18FNO6 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 2-[3-(4-fluorophenoxy)-4-oxochromen-7-yl]oxy-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc3c(=O)c(Oc4ccc(F)cc4)coc3c2)cc1 |
| InChI | InChI=1S/C24H18FNO6/c1-29-17-8-4-16(5-9-17)26-23(27)14-30-19-10-11-20-21(12-19)31-13-22(24(20)28)32-18-6-2-15(25)3-7-18/h2-13H,14H2,1H3,(H,26,27) |
| InChIKey | PJRPHFGGSDGZCS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |