About 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane
3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane (PubChem CID 23579729) has the molecular formula C17H32O2
and a molecular weight of 268.44 g/mol. Its IUPAC name is 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane.
Molecular Properties
| Compound Name | 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane |
| PubChem CID | 23579729 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane |
| SMILES | CCC1(CCCC2(CC)COC2(C)C)COC1(C)C |
| InChI | InChI=1S/C17H32O2/c1-7-16(12-18-14(16,3)4)10-9-11-17(8-2)13-19-15(17,5)6/h7-13H2,1-6H3 |
| InChIKey | PARQXNCHLUPYRH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane?
The IUPAC name of 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane (CID 23579729) is 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane.
What is the SMILES notation for 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane?
The canonical SMILES for 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane is CCC1(CCCC2(CC)COC2(C)C)COC1(C)C.
What is the InChIKey of 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane?
The InChIKey is PARQXNCHLUPYRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O2/c1-7-16(12-18-14(16,3)4)10-9-11-17(8-2)13-19-15(17,5)6/h7-13H2,1-6H3.
What are the key properties of 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane?
3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane has a molecular weight of 268.44 g/mol, XLogP of 4.57, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-[3-(3-ethyl-2,2-dimethyloxetan-3-yl)propyl]-2,2-dimethyloxetane is sourced from PubChem (CID 23579729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).