About [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate
[2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 2358036) has the molecular formula C13H14N2O5
and a molecular weight of 278.26 g/mol. Its IUPAC name is [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate.
Molecular Properties
| Compound Name | [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate |
| PubChem CID | 2358036 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14N2O5/c1-9(2)6-13(17)20-8-12(16)14-10-4-3-5-11(7-10)15(18)19/h3-7H,8H2,1-2H3,(H,14,16) |
| InChIKey | MWGWKBBWJNEYAQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate?
The IUPAC name of [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate (CID 2358036) is [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate.
What is the SMILES notation for [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate?
The canonical SMILES for [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate is CC(C)=CC(=O)OCC(=O)Nc1cccc([N+](=O)[O-])c1.
What is the InChIKey of [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate?
The InChIKey is MWGWKBBWJNEYAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O5/c1-9(2)6-13(17)20-8-12(16)14-10-4-3-5-11(7-10)15(18)19/h3-7H,8H2,1-2H3,(H,14,16).
What are the key properties of [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate?
[2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate has a molecular weight of 278.26 g/mol, XLogP of 2.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate is sourced from PubChem (CID 2358036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).