C27H36N4O6 — CID 23581265
diethyl 2-[1-(2-methoxypyrimidin-5-yl)-3-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]propanedioate (PubChem CID 23581265) has the molecular formula C27H36N4O6 and a molecular weight of 512.61 g/mol. Its IUPAC name is diethyl 2-[1-(2-methoxypyrimidin-5-yl)-3-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]propanedioate.
| Compound Name | diethyl 2-[1-(2-methoxypyrimidin-5-yl)-3-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]propanedioate |
|---|---|
| PubChem CID | 23581265 |
| Molecular Formula | C27H36N4O6 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | diethyl 2-[1-(2-methoxypyrimidin-5-yl)-3-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(CC(=O)CCCCc1ccc2c(n1)NCCC2)c1cnc(OC)nc1 |
| InChI | InChI=1S/C27H36N4O6/c1-4-36-25(33)23(26(34)37-5-2)22(19-16-29-27(35-3)30-17-19)15-21(32)11-7-6-10-20-13-12-18-9-8-14-28-24(18)31-20/h12-13,16-17,22-23H,4-11,14-15H2,1-3H3,(H,28,31) |
| InChIKey | QHNVOTISGBRIBA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|