C23H20N4OS — CID 23581434
1,3-dimethyl-5-[5-(4-methylphenyl)-2-thiophen-2-yl-1H-imidazol-4-yl]benzimidazol-2-one (PubChem CID 23581434) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is 1,3-dimethyl-5-[5-(4-methylphenyl)-2-thiophen-2-yl-1H-imidazol-4-yl]benzimidazol-2-one.
| Compound Name | 1,3-dimethyl-5-[5-(4-methylphenyl)-2-thiophen-2-yl-1H-imidazol-4-yl]benzimidazol-2-one |
|---|---|
| PubChem CID | 23581434 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1,3-dimethyl-5-[5-(4-methylphenyl)-2-thiophen-2-yl-1H-imidazol-4-yl]benzimidazol-2-one |
| SMILES | Cc1ccc(-c2[nH]c(-c3cccs3)nc2-c2ccc3c(c2)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C23H20N4OS/c1-14-6-8-15(9-7-14)20-21(25-22(24-20)19-5-4-12-29-19)16-10-11-17-18(13-16)27(3)23(28)26(17)2/h4-13H,1-3H3,(H,24,25) |
| InChIKey | HALLOURTJLSAGS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|