C25H22N6O2 — CID 23581563
[5-(3-methyl-2-oxo-1-phenylbenzimidazol-5-yl)-4-(3-methylphenyl)-1H-imidazol-2-yl]urea (PubChem CID 23581563) has the molecular formula C25H22N6O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is [5-(3-methyl-2-oxo-1-phenylbenzimidazol-5-yl)-4-(3-methylphenyl)-1H-imidazol-2-yl]urea.
| Compound Name | [5-(3-methyl-2-oxo-1-phenylbenzimidazol-5-yl)-4-(3-methylphenyl)-1H-imidazol-2-yl]urea |
|---|---|
| PubChem CID | 23581563 |
| Molecular Formula | C25H22N6O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [5-(3-methyl-2-oxo-1-phenylbenzimidazol-5-yl)-4-(3-methylphenyl)-1H-imidazol-2-yl]urea |
| SMILES | Cc1cccc(-c2nc(NC(N)=O)[nH]c2-c2ccc3c(c2)n(C)c(=O)n3-c2ccccc2)c1 |
| InChI | InChI=1S/C25H22N6O2/c1-15-7-6-8-16(13-15)21-22(28-24(27-21)29-23(26)32)17-11-12-19-20(14-17)30(2)25(33)31(19)18-9-4-3-5-10-18/h3-14H,1-2H3,(H4,26,27,28,29,32) |
| InChIKey | KGZOMWMZAASUHE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |