C35H43N11O7 — CID 23581854
N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 23581854) has the molecular formula C35H43N11O7 and a molecular weight of 729.80 g/mol. Its IUPAC name is N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 23581854 |
| Molecular Formula | C35H43N11O7 |
| Molecular Weight | 729.80 g/mol |
| Exact Mass | 729.33 |
| IUPAC Name | N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | [N-]=[N+]=NCCOCCOCCNC(=O)c1ccc(Nc2nc(NCCOCCOCCNC(=O)c3ccccc3)nc(Nc3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C35H43N11O7/c36-46-40-17-21-53-25-24-51-19-15-38-32(49)27-6-8-28(9-7-27)41-34-43-33(44-35(45-34)42-29-10-12-30(47)13-11-29)39-16-20-52-23-22-50-18-14-37-31(48)26-4-2-1-3-5-26/h1-13,47H,14-25H2,(H,37,48)(H,38,49)(H3,39,41,42,43,44,45) |
| InChIKey | LEWPUTUJPKJSGB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 238.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|