About N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide
N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide (PubChem CID 23581884) has the molecular formula C21H19NO3
and a molecular weight of 333.39 g/mol. Its IUPAC name is N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide.
Molecular Properties
| Compound Name | N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide |
| PubChem CID | 23581884 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(c2ccc(O)cc2)c2ccc(O)cc2)c1C |
| InChI | InChI=1S/C21H19NO3/c1-14-4-3-5-20(15(14)2)21(25)22(16-6-10-18(23)11-7-16)17-8-12-19(24)13-9-17/h3-13,23-24H,1-2H3 |
| InChIKey | NJUCPSQPZWRTIE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide?
The IUPAC name of N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide (CID 23581884) is N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide.
What is the SMILES notation for N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide?
The canonical SMILES for N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide is Cc1cccc(C(=O)N(c2ccc(O)cc2)c2ccc(O)cc2)c1C.
What is the InChIKey of N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide?
The InChIKey is NJUCPSQPZWRTIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO3/c1-14-4-3-5-20(15(14)2)21(25)22(16-6-10-18(23)11-7-16)17-8-12-19(24)13-9-17/h3-13,23-24H,1-2H3.
What are the key properties of N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide?
N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide has a molecular weight of 333.39 g/mol, XLogP of 4.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(4-hydroxyphenyl)-2,3-dimethylbenzamide is sourced from PubChem (CID 23581884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).