C24H25N5O — CID 23582189
N-(2-aminophenyl)-6-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylpyridine-3-carboxamide (PubChem CID 23582189) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylpyridine-3-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 23582189 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-(2-aminophenyl)-6-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylpyridine-3-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(N2CCC3(CC2)CNc2ccccc23)nc1 |
| InChI | InChI=1S/C24H25N5O/c25-19-6-2-4-8-21(19)28-23(30)17-9-10-22(26-15-17)29-13-11-24(12-14-29)16-27-20-7-3-1-5-18(20)24/h1-10,15,27H,11-14,16,25H2,(H,28,30) |
| InChIKey | MIMFQMSYGWSKSM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|