C21H25N3O4 — CID 23582244
(2S,3R,4S)-4-amino-N,3-dihydroxy-1-[4-(4-propylphenyl)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 23582244) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (2S,3R,4S)-4-amino-N,3-dihydroxy-1-[4-(4-propylphenyl)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,3R,4S)-4-amino-N,3-dihydroxy-1-[4-(4-propylphenyl)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23582244 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (2S,3R,4S)-4-amino-N,3-dihydroxy-1-[4-(4-propylphenyl)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCc1ccc(-c2ccc(C(=O)N3C[C@H](N)[C@@H](O)[C@H]3C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-2-3-13-4-6-14(7-5-13)15-8-10-16(11-9-15)21(27)24-12-17(22)19(25)18(24)20(26)23-28/h4-11,17-19,25,28H,2-3,12,22H2,1H3,(H,23,26)/t17-,18-,19+/m0/s1 |
| InChIKey | CYAFCMGGBURYQB-GBESFXJTSA-N |
| XLogP | 1.32 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|