About 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea
1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea (PubChem CID 23582287) has the molecular formula C13H19N5O
and a molecular weight of 261.33 g/mol. Its IUPAC name is 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea.
Molecular Properties
| Compound Name | 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea |
| PubChem CID | 23582287 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea |
| SMILES | O=C(Nc1ncn[nH]1)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C13H19N5O/c19-13(17-12-14-6-15-18-12)16-11-9-2-7-1-8(4-9)5-10(11)3-7/h6-11H,1-5H2,(H3,14,15,16,17,18,19) |
| InChIKey | FVNWRVVESGQORO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea?
The IUPAC name of 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea (CID 23582287) is 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea.
What is the SMILES notation for 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea?
The canonical SMILES for 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea is O=C(Nc1ncn[nH]1)NC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea?
The InChIKey is FVNWRVVESGQORO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5O/c19-13(17-12-14-6-15-18-12)16-11-9-2-7-1-8(4-9)5-10(11)3-7/h6-11H,1-5H2,(H3,14,15,16,17,18,19).
What are the key properties of 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea?
1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea has a molecular weight of 261.33 g/mol, XLogP of 1.75, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-adamantyl)-3-(1H-1,2,4-triazol-5-yl)urea is sourced from PubChem (CID 23582287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).