C18H20FN5O — CID 23582490
5-(4-amino-2-ethoxyphenyl)-N-(4-fluorophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine (PubChem CID 23582490) has the molecular formula C18H20FN5O and a molecular weight of 341.39 g/mol. Its IUPAC name is 5-(4-amino-2-ethoxyphenyl)-N-(4-fluorophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-amino-2-ethoxyphenyl)-N-(4-fluorophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 23582490 |
| Molecular Formula | C18H20FN5O |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 5-(4-amino-2-ethoxyphenyl)-N-(4-fluorophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
| SMILES | CCOc1cc(N)ccc1-c1nnc(N(C)c2ccc(F)cc2)n1C |
| InChI | InChI=1S/C18H20FN5O/c1-4-25-16-11-13(20)7-10-15(16)17-21-22-18(24(17)3)23(2)14-8-5-12(19)6-9-14/h5-11H,4,20H2,1-3H3 |
| InChIKey | JREJFPBVTBKSPJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|