C14H14F3N5O — CID 23582519
2-(2-aminopyrimidin-4-yl)-7-(3,3,3-trifluoropropyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 23582519) has the molecular formula C14H14F3N5O and a molecular weight of 325.29 g/mol. Its IUPAC name is 2-(2-aminopyrimidin-4-yl)-7-(3,3,3-trifluoropropyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-(2-aminopyrimidin-4-yl)-7-(3,3,3-trifluoropropyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 23582519 |
| Molecular Formula | C14H14F3N5O |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-(2-aminopyrimidin-4-yl)-7-(3,3,3-trifluoropropyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | Nc1nccc(-c2cc3c([nH]2)C(CCC(F)(F)F)CNC3=O)n1 |
| InChI | InChI=1S/C14H14F3N5O/c15-14(16,17)3-1-7-6-20-12(23)8-5-10(21-11(7)8)9-2-4-19-13(18)22-9/h2,4-5,7,21H,1,3,6H2,(H,20,23)(H2,18,19,22) |
| InChIKey | HOLYMSXFIGUWKL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |