C20H14N2O3 — CID 23582855
3-cyano-N,N-bis(4-hydroxyphenyl)benzamide (PubChem CID 23582855) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-cyano-N,N-bis(4-hydroxyphenyl)benzamide.
| Compound Name | 3-cyano-N,N-bis(4-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 23582855 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-cyano-N,N-bis(4-hydroxyphenyl)benzamide |
| SMILES | N#Cc1cccc(C(=O)N(c2ccc(O)cc2)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C20H14N2O3/c21-13-14-2-1-3-15(12-14)20(25)22(16-4-8-18(23)9-5-16)17-6-10-19(24)11-7-17/h1-12,23-24H |
| InChIKey | RZTUUNAFYAFTCO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |