C26H27NO2 — CID 23582962
methyl 2-[(S)-[benzyl-[(1S)-1-phenylethyl]amino]-phenylmethyl]prop-2-enoate (PubChem CID 23582962) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is methyl 2-[(S)-[benzyl-[(1S)-1-phenylethyl]amino]-phenylmethyl]prop-2-enoate.
| Compound Name | methyl 2-[(S)-[benzyl-[(1S)-1-phenylethyl]amino]-phenylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 23582962 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | methyl 2-[(S)-[benzyl-[(1S)-1-phenylethyl]amino]-phenylmethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@H](c1ccccc1)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H27NO2/c1-20(26(28)29-3)25(24-17-11-6-12-18-24)27(19-22-13-7-4-8-14-22)21(2)23-15-9-5-10-16-23/h4-18,21,25H,1,19H2,2-3H3/t21-,25+/m0/s1 |
| InChIKey | BXYWSTVVBVPGJJ-SQJMNOBHSA-N |
| XLogP | 5.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|