About N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine
N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine (PubChem CID 2358299) has the molecular formula C13H7F6NS
and a molecular weight of 323.26 g/mol. Its IUPAC name is N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine.
Molecular Properties
| Compound Name | N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine |
| PubChem CID | 2358299 |
| Molecular Formula | C13H7F6NS |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine |
| SMILES | FC(F)(F)c1ccc(/N=C/c2ccsc2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H7F6NS/c14-12(15,16)10-2-1-9(5-11(10)13(17,18)19)20-6-8-3-4-21-7-8/h1-7H/b20-6+ |
| InChIKey | CQRAWPFEOPPMLR-CGOBSMCZSA-N |
| XLogP | 5.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine?
The IUPAC name of N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine (CID 2358299) is N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine.
What is the SMILES notation for N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine?
The canonical SMILES for N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine is FC(F)(F)c1ccc(/N=C/c2ccsc2)cc1C(F)(F)F.
What is the InChIKey of N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine?
The InChIKey is CQRAWPFEOPPMLR-CGOBSMCZSA-N. The full InChI is InChI=1S/C13H7F6NS/c14-12(15,16)10-2-1-9(5-11(10)13(17,18)19)20-6-8-3-4-21-7-8/h1-7H/b20-6+.
What are the key properties of N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine?
N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine has a molecular weight of 323.26 g/mol, XLogP of 5.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,4-bis(trifluoromethyl)phenyl]-1-thiophen-3-ylmethanimine is sourced from PubChem (CID 2358299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).