C18H30O2Si — CID 23583616
(5aS,7aS,11aS,11bS)-4,4,8,8,11a-pentamethyl-5a,7a,9,10,11,11b-hexahydro-5H-benzo[g][3,2]benzoxasilepin-1-one (PubChem CID 23583616) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is (5aS,7aS,11aS,11bS)-4,4,8,8,11a-pentamethyl-5a,7a,9,10,11,11b-hexahydro-5H-benzo[g][3,2]benzoxasilepin-1-one.
| Compound Name | (5aS,7aS,11aS,11bS)-4,4,8,8,11a-pentamethyl-5a,7a,9,10,11,11b-hexahydro-5H-benzo[g][3,2]benzoxasilepin-1-one |
|---|---|
| PubChem CID | 23583616 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (5aS,7aS,11aS,11bS)-4,4,8,8,11a-pentamethyl-5a,7a,9,10,11,11b-hexahydro-5H-benzo[g][3,2]benzoxasilepin-1-one |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3C(=O)CO[Si](C)(C)C[C@H]3C=C[C@@H]12 |
| InChI | InChI=1S/C18H30O2Si/c1-17(2)9-6-10-18(3)15(17)8-7-13-12-21(4,5)20-11-14(19)16(13)18/h7-8,13,15-16H,6,9-12H2,1-5H3/t13-,15+,16-,18+/m1/s1 |
| InChIKey | DXAZOOVWOBUUED-VUNQQRPYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|