C20H32O10S — CID 23583628
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-propylsulfanylpropoxy)oxan-2-yl]methyl acetate (PubChem CID 23583628) has the molecular formula C20H32O10S and a molecular weight of 464.53 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-propylsulfanylpropoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-propylsulfanylpropoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23583628 |
| Molecular Formula | C20H32O10S |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-propylsulfanylpropoxy)oxan-2-yl]methyl acetate |
| SMILES | CCCSCCCO[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H32O10S/c1-6-9-31-10-7-8-25-20-19(29-15(5)24)18(28-14(4)23)17(27-13(3)22)16(30-20)11-26-12(2)21/h16-20H,6-11H2,1-5H3/t16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | OAHAYFGQVOOAHU-LCWAXJCOSA-N |
| XLogP | 1.62 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|