C21H34O10S — CID 23583629
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-butylsulfanylpropoxy)oxan-2-yl]methyl acetate (PubChem CID 23583629) has the molecular formula C21H34O10S and a molecular weight of 478.56 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-butylsulfanylpropoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-butylsulfanylpropoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23583629 |
| Molecular Formula | C21H34O10S |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-butylsulfanylpropoxy)oxan-2-yl]methyl acetate |
| SMILES | CCCCSCCCO[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H34O10S/c1-6-7-10-32-11-8-9-26-21-20(30-16(5)25)19(29-15(4)24)18(28-14(3)23)17(31-21)12-27-13(2)22/h17-21H,6-12H2,1-5H3/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | XZKOJZOFZLRRLD-XDWAVFMPSA-N |
| XLogP | 2.01 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|