C16H21NO5 — CID 23583730
diethyl (4S,5R)-2-benzyl-1,2-oxazolidine-4,5-dicarboxylate (PubChem CID 23583730) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is diethyl (4S,5R)-2-benzyl-1,2-oxazolidine-4,5-dicarboxylate.
| Compound Name | diethyl (4S,5R)-2-benzyl-1,2-oxazolidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 23583730 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | diethyl (4S,5R)-2-benzyl-1,2-oxazolidine-4,5-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CN(Cc2ccccc2)O[C@H]1C(=O)OCC |
| InChI | InChI=1S/C16H21NO5/c1-3-20-15(18)13-11-17(10-12-8-6-5-7-9-12)22-14(13)16(19)21-4-2/h5-9,13-14H,3-4,10-11H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | SIHUMCCKQLUUFN-UONOGXRCSA-N |
| XLogP | 1.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |