C56H39Cl4N3 — CID 23583773
2,7,12,17-tetrakis(4-chlorophenyl)-22-phenyl-27,28,29-triazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),3,5,8,10,13,15,18,20,22,24-undecaene (PubChem CID 23583773) has the molecular formula C56H39Cl4N3 and a molecular weight of 895.76 g/mol. Its IUPAC name is 2,7,12,17-tetrakis(4-chlorophenyl)-22-phenyl-27,28,29-triazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),3,5,8,10,13,15,18,20,22,24-undecaene.
| Compound Name | 2,7,12,17-tetrakis(4-chlorophenyl)-22-phenyl-27,28,29-triazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),3,5,8,10,13,15,18,20,22,24-undecaene |
|---|---|
| PubChem CID | 23583773 |
| Molecular Formula | C56H39Cl4N3 |
| Molecular Weight | 895.76 g/mol |
| Exact Mass | 893.19 |
| IUPAC Name | 2,7,12,17-tetrakis(4-chlorophenyl)-22-phenyl-27,28,29-triazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),3,5,8,10,13,15,18,20,22,24-undecaene |
| SMILES | Clc1ccc(C2c3ccc([nH]3)C(c3ccc(Cl)cc3)c3ccc([nH]3)C(c3ccc(Cl)cc3)c3cc(c4ccc(-c5ccccc5)ccc3-4)C(c3ccc(Cl)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C56H39Cl4N3/c57-39-16-6-35(7-17-39)53-45-32-46(44-25-15-34(14-24-43(44)45)33-4-2-1-3-5-33)54(36-8-18-40(58)19-9-36)48-27-29-50(62-48)56(38-12-22-42(60)23-13-38)52-31-30-51(63-52)55(49-28-26-47(53)61-49)37-10-20-41(59)21-11-37/h1-32,53-56,61-63H |
| InChIKey | PHUOGRIUUGXLJW-UHFFFAOYSA-N |
| XLogP | 16.09 |
| TPSA | 47.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.76 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |