C20H22O2 — CID 23583974
(1S,2S,3S,4R)-3-ethenyl-4-(4-methoxyphenyl)-2-methyl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 23583974) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-ethenyl-4-(4-methoxyphenyl)-2-methyl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1S,2S,3S,4R)-3-ethenyl-4-(4-methoxyphenyl)-2-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 23583974 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (1S,2S,3S,4R)-3-ethenyl-4-(4-methoxyphenyl)-2-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | C=C[C@H]1[C@H](c2ccc(OC)cc2)c2ccccc2[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C20H22O2/c1-4-16-13(2)20(21)18-8-6-5-7-17(18)19(16)14-9-11-15(22-3)12-10-14/h4-13,16,19-21H,1H2,2-3H3/t13-,16+,19-,20-/m0/s1 |
| InChIKey | YUDLATQAYYAANG-MVHCQYFOSA-N |
| XLogP | 4.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|