C21H32ClNO3 — CID 2358404
[2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 2358404) has the molecular formula C21H32ClNO3 and a molecular weight of 381.94 g/mol. Its IUPAC name is [2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 2358404 |
| Molecular Formula | C21H32ClNO3 |
| Molecular Weight | 381.94 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | [2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | C[C@H]1[C@@H](C)CCC[C@H]1NC(=O)COC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C21H32ClNO3/c1-13-4-3-5-17(14(13)2)23-18(24)11-26-19(25)20-7-15-6-16(8-20)10-21(22,9-15)12-20/h13-17H,3-12H2,1-2H3,(H,23,24)/t13-,14-,15-,16+,17+,20?,21?/m0/s1 |
| InChIKey | LQYORCZKQPYILT-POTPBMGPSA-N |
| XLogP | 4.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.94 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|