C18H23NO13 — CID 23584093
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 23584093) has the molecular formula C18H23NO13 and a molecular weight of 461.38 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23584093 |
| Molecular Formula | C18H23NO13 |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC[C@@H]2NC(=O)OC2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H23NO13/c1-7(20)26-6-12-13(28-8(2)21)14(29-9(3)22)15(30-10(4)23)17(31-12)27-5-11-16(24)32-18(25)19-11/h11-15,17H,5-6H2,1-4H3,(H,19,25)/t11-,12+,13+,14-,15+,17+/m0/s1 |
| InChIKey | VGHLHVOCQDYOJE-MCDJNTACSA-N |
| XLogP | -1.28 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|