C19H30O10S — CID 23584226
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-ethylsulfanylpropoxy)oxan-2-yl]methyl acetate (PubChem CID 23584226) has the molecular formula C19H30O10S and a molecular weight of 450.51 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-ethylsulfanylpropoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-ethylsulfanylpropoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23584226 |
| Molecular Formula | C19H30O10S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-ethylsulfanylpropoxy)oxan-2-yl]methyl acetate |
| SMILES | CCSCCCO[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H30O10S/c1-6-30-9-7-8-24-19-18(28-14(5)23)17(27-13(4)22)16(26-12(3)21)15(29-19)10-25-11(2)20/h15-19H,6-10H2,1-5H3/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | MQXFBAXLBUYEJO-ICBNADEASA-N |
| XLogP | 1.23 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|