About 1-azaspiro[4.4]non-8-ene
1-azaspiro[4.4]non-8-ene (PubChem CID 23584231) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 1-azaspiro[4.4]non-8-ene.
Molecular Properties
| Compound Name | 1-azaspiro[4.4]non-8-ene |
| PubChem CID | 23584231 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 1-azaspiro[4.4]non-8-ene |
| SMILES | C1=CC2(CC1)CCCN2 |
| InChI | InChI=1S/C8H13N/c1-2-5-8(4-1)6-3-7-9-8/h1,4,9H,2-3,5-7H2 |
| InChIKey | MFYPUDHVTGBEJY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-azaspiro[4.4]non-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azaspiro[4.4]non-8-ene?
The IUPAC name of 1-azaspiro[4.4]non-8-ene (CID 23584231) is 1-azaspiro[4.4]non-8-ene.
What is the SMILES notation for 1-azaspiro[4.4]non-8-ene?
The canonical SMILES for 1-azaspiro[4.4]non-8-ene is C1=CC2(CC1)CCCN2.
What is the InChIKey of 1-azaspiro[4.4]non-8-ene?
The InChIKey is MFYPUDHVTGBEJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-2-5-8(4-1)6-3-7-9-8/h1,4,9H,2-3,5-7H2.
What are the key properties of 1-azaspiro[4.4]non-8-ene?
1-azaspiro[4.4]non-8-ene has a molecular weight of 123.20 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azaspiro[4.4]non-8-ene is sourced from PubChem (CID 23584231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).