C14H20Br2OSi — CID 23584421
[(3E,4E)-3,4-bis(bromomethylidene)cyclohexa-1,5-dien-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 23584421) has the molecular formula C14H20Br2OSi and a molecular weight of 392.21 g/mol. Its IUPAC name is [(3E,4E)-3,4-bis(bromomethylidene)cyclohexa-1,5-dien-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3E,4E)-3,4-bis(bromomethylidene)cyclohexa-1,5-dien-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 23584421 |
| Molecular Formula | C14H20Br2OSi |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | [(3E,4E)-3,4-bis(bromomethylidene)cyclohexa-1,5-dien-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(=C\Br)/c(=C/Br)c1 |
| InChI | InChI=1S/C14H20Br2OSi/c1-14(2,3)18(4,5)17-13-7-6-11(9-15)12(8-13)10-16/h6-10H,1-5H3/b11-9+,12-10+ |
| InChIKey | POSMGWXPGYVKRJ-WGDLNXRISA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|