C22H40O6Si — CID 23584761
[(1R,5R,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-3-oxo-2-oxabicyclo[3.3.1]nonan-9-yl] acetate (PubChem CID 23584761) has the molecular formula C22H40O6Si and a molecular weight of 428.64 g/mol. Its IUPAC name is [(1R,5R,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-3-oxo-2-oxabicyclo[3.3.1]nonan-9-yl] acetate.
| Compound Name | [(1R,5R,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-3-oxo-2-oxabicyclo[3.3.1]nonan-9-yl] acetate |
|---|---|
| PubChem CID | 23584761 |
| Molecular Formula | C22H40O6Si |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | [(1R,5R,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-3-oxo-2-oxabicyclo[3.3.1]nonan-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@]2(C)CC(=O)O[C@@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2OC(C)(C)C |
| InChI | InChI=1S/C22H40O6Si/c1-14(23)25-18-21(8)13-17(24)27-22(18,9)16(12-15(21)26-19(2,3)4)28-29(10,11)20(5,6)7/h15-16,18H,12-13H2,1-11H3/t15-,16-,18-,21+,22-/m0/s1 |
| InChIKey | RSNZCRQUVAPOJS-XTMYYITASA-N |
| XLogP | 4.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|