C23H21F3N2O — CID 23585156
(2S)-2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine (PubChem CID 23585156) has the molecular formula C23H21F3N2O and a molecular weight of 398.43 g/mol. Its IUPAC name is (2S)-2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine.
| Compound Name | (2S)-2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine |
|---|---|
| PubChem CID | 23585156 |
| Molecular Formula | C23H21F3N2O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (2S)-2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine |
| SMILES | FC(F)(F)c1ccccc1-c1ccc(CN2CCO[C@@H](c3ccccc3)C2)cn1 |
| InChI | InChI=1S/C23H21F3N2O/c24-23(25,26)20-9-5-4-8-19(20)21-11-10-17(14-27-21)15-28-12-13-29-22(16-28)18-6-2-1-3-7-18/h1-11,14,22H,12-13,15-16H2/t22-/m1/s1 |
| InChIKey | KTNHCANDRPSCRF-JOCHJYFZSA-N |
| XLogP | 5.34 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |