C30H36FN7OS — CID 23585228
3-[[2-[4-(4-cyclohexylpiperazin-1-yl)-3-fluoroanilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 23585228) has the molecular formula C30H36FN7OS and a molecular weight of 561.73 g/mol. Its IUPAC name is 3-[[2-[4-(4-cyclohexylpiperazin-1-yl)-3-fluoroanilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[[2-[4-(4-cyclohexylpiperazin-1-yl)-3-fluoroanilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 23585228 |
| Molecular Formula | C30H36FN7OS |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | 3-[[2-[4-(4-cyclohexylpiperazin-1-yl)-3-fluoroanilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)C1C2C=CC(C2)C1Nc1nc(Nc2ccc(N3CCN(C4CCCCC4)CC3)c(F)c2)nc2ccsc12 |
| InChI | InChI=1S/C30H36FN7OS/c31-22-17-20(8-9-24(22)38-13-11-37(12-14-38)21-4-2-1-3-5-21)33-30-34-23-10-15-40-27(23)29(36-30)35-26-19-7-6-18(16-19)25(26)28(32)39/h6-10,15,17-19,21,25-26H,1-5,11-14,16H2,(H2,32,39)(H2,33,34,35,36) |
| InChIKey | RUGBBIJFFHZZCX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|