C17H15N5O — CID 23585246
2-(2-aminopyrimidin-4-yl)-1-phenyl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one (PubChem CID 23585246) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-(2-aminopyrimidin-4-yl)-1-phenyl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-(2-aminopyrimidin-4-yl)-1-phenyl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 23585246 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-(2-aminopyrimidin-4-yl)-1-phenyl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one |
| SMILES | Nc1nccc(-c2cc3c(n2-c2ccccc2)CCNC3=O)n1 |
| InChI | InChI=1S/C17H15N5O/c18-17-20-8-6-13(21-17)15-10-12-14(7-9-19-16(12)23)22(15)11-4-2-1-3-5-11/h1-6,8,10H,7,9H2,(H,19,23)(H2,18,20,21) |
| InChIKey | UDXMXAGSJLKOGP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|