About 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone
1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone (PubChem CID 23585262) has the molecular formula C21H12ClF2NOS
and a molecular weight of 399.85 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone.
Molecular Properties
| Compound Name | 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone |
| PubChem CID | 23585262 |
| Molecular Formula | C21H12ClF2NOS |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)c(F)c1)c1sc2ncccc2c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H12ClF2NOS/c22-14-6-4-13(5-7-14)19-15-2-1-9-25-21(15)27-20(19)18(26)11-12-3-8-16(23)17(24)10-12/h1-10H,11H2 |
| InChIKey | AISXHWGRSAOXBS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone?
The IUPAC name of 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone (CID 23585262) is 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone.
What is the SMILES notation for 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone?
The canonical SMILES for 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone is O=C(Cc1ccc(F)c(F)c1)c1sc2ncccc2c1-c1ccc(Cl)cc1.
What is the InChIKey of 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone?
The InChIKey is AISXHWGRSAOXBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12ClF2NOS/c22-14-6-4-13(5-7-14)19-15-2-1-9-25-21(15)27-20(19)18(26)11-12-3-8-16(23)17(24)10-12/h1-10H,11H2.
What are the key properties of 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone?
1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone has a molecular weight of 399.85 g/mol, XLogP of 6.32, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-chlorophenyl)thieno[2,3-b]pyridin-2-yl]-2-(3,4-difluorophenyl)ethanone is sourced from PubChem (CID 23585262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).