C26H30FN7OS — CID 23585274
3-[[2-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 23585274) has the molecular formula C26H30FN7OS and a molecular weight of 507.64 g/mol. Its IUPAC name is 3-[[2-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[[2-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 23585274 |
| Molecular Formula | C26H30FN7OS |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 3-[[2-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CN1CCCN(c2ccc(Nc3nc(NC4C5C=CC(C5)C4C(N)=O)c4sccc4n3)cc2F)CC1 |
| InChI | InChI=1S/C26H30FN7OS/c1-33-8-2-9-34(11-10-33)20-6-5-17(14-18(20)27)29-26-30-19-7-12-36-23(19)25(32-26)31-22-16-4-3-15(13-16)21(22)24(28)35/h3-7,12,14-16,21-22H,2,8-11,13H2,1H3,(H2,28,35)(H2,29,30,31,32) |
| InChIKey | ZNZMQOZFWQCDGN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|