C29H36FN7OS — CID 23585332
(2S,3R)-3-[[2-[4-[4-(diethylamino)piperidin-1-yl]-3-fluoroanilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 23585332) has the molecular formula C29H36FN7OS and a molecular weight of 549.72 g/mol. Its IUPAC name is (2S,3R)-3-[[2-[4-[4-(diethylamino)piperidin-1-yl]-3-fluoroanilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (2S,3R)-3-[[2-[4-[4-(diethylamino)piperidin-1-yl]-3-fluoroanilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 23585332 |
| Molecular Formula | C29H36FN7OS |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | (2S,3R)-3-[[2-[4-[4-(diethylamino)piperidin-1-yl]-3-fluoroanilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCN(CC)C1CCN(c2ccc(Nc3nc(N[C@@H]4C5C=CC(C5)[C@@H]4C(N)=O)c4sccc4n3)cc2F)CC1 |
| InChI | InChI=1S/C29H36FN7OS/c1-3-36(4-2)20-9-12-37(13-10-20)23-8-7-19(16-21(23)30)32-29-33-22-11-14-39-26(22)28(35-29)34-25-18-6-5-17(15-18)24(25)27(31)38/h5-8,11,14,16-18,20,24-25H,3-4,9-10,12-13,15H2,1-2H3,(H2,31,38)(H2,32,33,34,35)/t17?,18?,24-,25+/m0/s1 |
| InChIKey | BNTHFSVIEYZUFY-QNXMCKPUSA-N |
| XLogP | 4.97 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|