C18H21BrN6 — CID 23585419
4-(6-bromo-7-piperazin-1-yl-1H-imidazo[4,5-b]pyridin-2-yl)-N,N-dimethylaniline (PubChem CID 23585419) has the molecular formula C18H21BrN6 and a molecular weight of 401.31 g/mol. Its IUPAC name is 4-(6-bromo-7-piperazin-1-yl-1H-imidazo[4,5-b]pyridin-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(6-bromo-7-piperazin-1-yl-1H-imidazo[4,5-b]pyridin-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 23585419 |
| Molecular Formula | C18H21BrN6 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 4-(6-bromo-7-piperazin-1-yl-1H-imidazo[4,5-b]pyridin-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc3ncc(Br)c(N4CCNCC4)c3[nH]2)cc1 |
| InChI | InChI=1S/C18H21BrN6/c1-24(2)13-5-3-12(4-6-13)17-22-15-16(25-9-7-20-8-10-25)14(19)11-21-18(15)23-17/h3-6,11,20H,7-10H2,1-2H3,(H,21,22,23) |
| InChIKey | JHIAAOWEBWPFOE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|