C20H30O4 — CID 23585788
(4E,8Z)-2,10-dihydroxy-4,8,12-trimethyl-16-methylidene-14-oxabicyclo[11.3.1]heptadeca-4,8-dien-15-one (PubChem CID 23585788) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (4E,8Z)-2,10-dihydroxy-4,8,12-trimethyl-16-methylidene-14-oxabicyclo[11.3.1]heptadeca-4,8-dien-15-one.
| Compound Name | (4E,8Z)-2,10-dihydroxy-4,8,12-trimethyl-16-methylidene-14-oxabicyclo[11.3.1]heptadeca-4,8-dien-15-one |
|---|---|
| PubChem CID | 23585788 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (4E,8Z)-2,10-dihydroxy-4,8,12-trimethyl-16-methylidene-14-oxabicyclo[11.3.1]heptadeca-4,8-dien-15-one |
| SMILES | C=C1C(=O)OC2CC1C(O)C/C(C)=C/CC/C(C)=C\C(O)CC2C |
| InChI | InChI=1S/C20H30O4/c1-12-6-5-7-13(2)9-18(22)17-11-19(24-20(23)15(17)4)14(3)10-16(21)8-12/h7-8,14,16-19,21-22H,4-6,9-11H2,1-3H3/b12-8-,13-7+ |
| InChIKey | GQTPRLWQZDUWKJ-CZAVNJROSA-N |
| XLogP | 3.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|