About CID 23585820
CID 23585820 (PubChem CID 23585820) has the molecular formula C8H9AlO2S
and a molecular weight of 196.21 g/mol.
Molecular Properties
| Compound Name | CID 23585820 |
| PubChem CID | 23585820 |
| Molecular Formula | C8H9AlO2S |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | — |
| SMILES | O.O.[Al]c1cc2ccccc2s1 |
| InChI | InChI=1S/C8H5S.Al.2H2O/c1-2-4-8-7(3-1)5-6-9-8;;;/h1-5H;;2*1H2 |
| InChIKey | UHRMPWMPPZAHJC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 23585820 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23585820?
The IUPAC name of CID 23585820 (CID 23585820) is not available.
What is the SMILES notation for CID 23585820?
The canonical SMILES for CID 23585820 is O.O.[Al]c1cc2ccccc2s1.
What is the InChIKey of CID 23585820?
The InChIKey is UHRMPWMPPZAHJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5S.Al.2H2O/c1-2-4-8-7(3-1)5-6-9-8;;;/h1-5H;;2*1H2.
What are the key properties of CID 23585820?
CID 23585820 has a molecular weight of 196.21 g/mol, XLogP of 0.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23585820 is sourced from PubChem (CID 23585820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).