About (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid
(2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid (PubChem CID 23585827) has the molecular formula C11H18N2O2S
and a molecular weight of 242.34 g/mol. Its IUPAC name is (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid |
| PubChem CID | 23585827 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid |
| SMILES | CS(N)(N)C[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H18N2O2S/c1-16(12,13)8-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7-8,12-13H2,1H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | PIFNBEQHUNXXMF-SNVBAGLBSA-N |
| XLogP | 1.11 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid?
The IUPAC name of (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid (CID 23585827) is (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid.
What is the SMILES notation for (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid?
The canonical SMILES for (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid is CS(N)(N)C[C@@H](Cc1ccccc1)C(=O)O.
What is the InChIKey of (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid?
The InChIKey is PIFNBEQHUNXXMF-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-16(12,13)8-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7-8,12-13H2,1H3,(H,14,15)/t10-/m1/s1.
What are the key properties of (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid?
(2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid has a molecular weight of 242.34 g/mol, XLogP of 1.11, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-benzyl-3-[diamino(methyl)-λ4-sulfanyl]propanoic acid is sourced from PubChem (CID 23585827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).