C15H31AlN4O5 — CID 23586016
CID 23586016 (PubChem CID 23586016) has the molecular formula C15H31AlN4O5 and a molecular weight of 374.42 g/mol.
| Compound Name | CID 23586016 |
|---|---|
| PubChem CID | 23586016 |
| Molecular Formula | C15H31AlN4O5 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | — |
| SMILES | CC(C)[C@@H]([Al])NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@H](C)N.O.O |
| InChI | InChI=1S/C15H27N4O3.Al.2H2O/c1-9(2)8-17-14(21)12-6-5-7-19(12)15(22)11(4)18-13(20)10(3)16;;;/h8-12H,5-7,16H2,1-4H3,(H,17,21)(H,18,20);;2*1H2/t10-,11-,12-;;;/m0.../s1 |
| InChIKey | BEKZSYAIAUKWLT-YSZXOBSOSA-N |
| XLogP | -2.55 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |