C13H14N4O2 — CID 23586149
7,8,10-trimethyl-1,10a-dihydrobenzo[g]pteridine-2,4-dione (PubChem CID 23586149) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 7,8,10-trimethyl-1,10a-dihydrobenzo[g]pteridine-2,4-dione.
| Compound Name | 7,8,10-trimethyl-1,10a-dihydrobenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 23586149 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 7,8,10-trimethyl-1,10a-dihydrobenzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2c(cc1C)N(C)C1NC(=O)NC(=O)C1=N2 |
| InChI | InChI=1S/C13H14N4O2/c1-6-4-8-9(5-7(6)2)17(3)11-10(14-8)12(18)16-13(19)15-11/h4-5,11H,1-3H3,(H2,15,16,18,19) |
| InChIKey | WWJLVORKSFZDDU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |