About (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol
(2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol (PubChem CID 23586157) has the molecular formula C11H21F3OS
and a molecular weight of 258.35 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol.
Molecular Properties
| Compound Name | (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol |
| PubChem CID | 23586157 |
| Molecular Formula | C11H21F3OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol |
| SMILES | CCCCCCCCSC[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C11H21F3OS/c1-2-3-4-5-6-7-8-16-9-10(15)11(12,13)14/h10,15H,2-9H2,1H3/t10-/m1/s1 |
| InChIKey | NYQQLQHJFSOKJP-SNVBAGLBSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol?
The IUPAC name of (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol (CID 23586157) is (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol.
What is the SMILES notation for (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol?
The canonical SMILES for (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol is CCCCCCCCSC[C@@H](O)C(F)(F)F.
What is the InChIKey of (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol?
The InChIKey is NYQQLQHJFSOKJP-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H21F3OS/c1-2-3-4-5-6-7-8-16-9-10(15)11(12,13)14/h10,15H,2-9H2,1H3/t10-/m1/s1.
What are the key properties of (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol?
(2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol has a molecular weight of 258.35 g/mol, XLogP of 4.00, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,1,1-trifluoro-3-octylsulfanylpropan-2-ol is sourced from PubChem (CID 23586157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).