About 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid
2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid (PubChem CID 23586413) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid.
Molecular Properties
| Compound Name | 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid |
| PubChem CID | 23586413 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid |
| SMILES | CC1=Nc2ccccc2C12CCC(C(=O)O)CC2 |
| InChI | InChI=1S/C15H17NO2/c1-10-15(8-6-11(7-9-15)14(17)18)12-4-2-3-5-13(12)16-10/h2-5,11H,6-9H2,1H3,(H,17,18) |
| InChIKey | KIEIUOXSQHEISR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid?
The IUPAC name of 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid (CID 23586413) is 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid.
What is the SMILES notation for 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid?
The canonical SMILES for 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid is CC1=Nc2ccccc2C12CCC(C(=O)O)CC2.
What is the InChIKey of 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid?
The InChIKey is KIEIUOXSQHEISR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2/c1-10-15(8-6-11(7-9-15)14(17)18)12-4-2-3-5-13(12)16-10/h2-5,11H,6-9H2,1H3,(H,17,18).
What are the key properties of 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid?
2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid has a molecular weight of 243.31 g/mol, XLogP of 3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-methylspiro[cyclohexane-4,3'-indole]-1-carboxylic acid is sourced from PubChem (CID 23586413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).