C24H36N2O2 — CID 23587729
1-butyl-N-[2-(cyclohexen-1-yl)ethyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide (PubChem CID 23587729) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 1-butyl-N-[2-(cyclohexen-1-yl)ethyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide.
| Compound Name | 1-butyl-N-[2-(cyclohexen-1-yl)ethyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23587729 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 1-butyl-N-[2-(cyclohexen-1-yl)ethyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
| SMILES | CCCCn1c2c(cc(C(=O)NCCC3=CCCCC3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C24H36N2O2/c1-2-3-17-26-22-14-10-5-4-9-13-20(22)18-21(24(26)28)23(27)25-16-15-19-11-7-6-8-12-19/h11,18H,2-10,12-17H2,1H3,(H,25,27) |
| InChIKey | LRVIDTXKUSMLTG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|