C24H38N2O4 — CID 23587743
1-butyl-N-(2-cyclohexyl-2-hydroxyethyl)-N-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide (PubChem CID 23587743) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is 1-butyl-N-(2-cyclohexyl-2-hydroxyethyl)-N-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide.
| Compound Name | 1-butyl-N-(2-cyclohexyl-2-hydroxyethyl)-N-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23587743 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 1-butyl-N-(2-cyclohexyl-2-hydroxyethyl)-N-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
| SMILES | CCCCn1c2c(cc(C(=O)N(O)CC(O)C3CCCCC3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C24H38N2O4/c1-2-3-15-25-21-14-10-5-4-7-13-19(21)16-20(23(25)28)24(29)26(30)17-22(27)18-11-8-6-9-12-18/h16,18,22,27,30H,2-15,17H2,1H3 |
| InChIKey | LSCVFQRMQHNETR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|