C23H32N2O2 — CID 23587815
1-butyl-5-ethyl-2-oxo-N-(2-phenylethyl)-6-propylpyridine-3-carboxamide (PubChem CID 23587815) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-butyl-5-ethyl-2-oxo-N-(2-phenylethyl)-6-propylpyridine-3-carboxamide.
| Compound Name | 1-butyl-5-ethyl-2-oxo-N-(2-phenylethyl)-6-propylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 23587815 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-butyl-5-ethyl-2-oxo-N-(2-phenylethyl)-6-propylpyridine-3-carboxamide |
| SMILES | CCCCn1c(CCC)c(CC)cc(C(=O)NCCc2ccccc2)c1=O |
| InChI | InChI=1S/C23H32N2O2/c1-4-7-16-25-21(11-5-2)19(6-3)17-20(23(25)27)22(26)24-15-14-18-12-9-8-10-13-18/h8-10,12-13,17H,4-7,11,14-16H2,1-3H3,(H,24,26) |
| InChIKey | OTGGJAXHHDXNJE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |