About 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one
1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one (PubChem CID 23587855) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one |
| PubChem CID | 23587855 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one |
| SMILES | [C-]#[N+]c1cc(C)c(C)n(CC)c1=O |
| InChI | InChI=1S/C10H12N2O/c1-5-12-8(3)7(2)6-9(11-4)10(12)13/h6H,5H2,1-3H3 |
| InChIKey | MEKSDQVMPQVCCS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 26.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one?
The IUPAC name of 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one (CID 23587855) is 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one.
What is the SMILES notation for 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one?
The canonical SMILES for 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one is [C-]#[N+]c1cc(C)c(C)n(CC)c1=O.
What is the InChIKey of 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one?
The InChIKey is MEKSDQVMPQVCCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-5-12-8(3)7(2)6-9(11-4)10(12)13/h6H,5H2,1-3H3.
What are the key properties of 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one?
1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one has a molecular weight of 176.22 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-isocyano-5,6-dimethylpyridin-2-one is sourced from PubChem (CID 23587855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).