About 1-bromo-2-tert-butyl-4,5-dimethylbenzene
1-bromo-2-tert-butyl-4,5-dimethylbenzene (PubChem CID 23588940) has the molecular formula C12H17Br
and a molecular weight of 241.17 g/mol. Its IUPAC name is 1-bromo-2-tert-butyl-4,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-bromo-2-tert-butyl-4,5-dimethylbenzene |
| PubChem CID | 23588940 |
| Molecular Formula | C12H17Br |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1-bromo-2-tert-butyl-4,5-dimethylbenzene |
| SMILES | Cc1cc(Br)c(C(C)(C)C)cc1C |
| InChI | InChI=1S/C12H17Br/c1-8-6-10(12(3,4)5)11(13)7-9(8)2/h6-7H,1-5H3 |
| InChIKey | REFXBAJSJLVJKS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-2-tert-butyl-4,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-tert-butyl-4,5-dimethylbenzene?
The IUPAC name of 1-bromo-2-tert-butyl-4,5-dimethylbenzene (CID 23588940) is 1-bromo-2-tert-butyl-4,5-dimethylbenzene.
What is the SMILES notation for 1-bromo-2-tert-butyl-4,5-dimethylbenzene?
The canonical SMILES for 1-bromo-2-tert-butyl-4,5-dimethylbenzene is Cc1cc(Br)c(C(C)(C)C)cc1C.
What is the InChIKey of 1-bromo-2-tert-butyl-4,5-dimethylbenzene?
The InChIKey is REFXBAJSJLVJKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Br/c1-8-6-10(12(3,4)5)11(13)7-9(8)2/h6-7H,1-5H3.
What are the key properties of 1-bromo-2-tert-butyl-4,5-dimethylbenzene?
1-bromo-2-tert-butyl-4,5-dimethylbenzene has a molecular weight of 241.17 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-tert-butyl-4,5-dimethylbenzene is sourced from PubChem (CID 23588940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).