C11H17F3N2O5S2 — CID 23589208
S-[2-[[(2R)-3-acetylsulfanyl-2-aminopropanoyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid (PubChem CID 23589208) has the molecular formula C11H17F3N2O5S2 and a molecular weight of 378.39 g/mol. Its IUPAC name is S-[2-[[(2R)-3-acetylsulfanyl-2-aminopropanoyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid.
| Compound Name | S-[2-[[(2R)-3-acetylsulfanyl-2-aminopropanoyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23589208 |
| Molecular Formula | C11H17F3N2O5S2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | S-[2-[[(2R)-3-acetylsulfanyl-2-aminopropanoyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)SCCNC(=O)[C@@H](N)CSC(C)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H16N2O3S2.C2HF3O2/c1-6(12)15-4-3-11-9(14)8(10)5-16-7(2)13;3-2(4,5)1(6)7/h8H,3-5,10H2,1-2H3,(H,11,14);(H,6,7)/t8-;/m0./s1 |
| InChIKey | NGUVAKDDJZCGMV-QRPNPIFTSA-N |
| XLogP | 0.62 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|