About [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate
[1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate (PubChem CID 23589368) has the molecular formula C26H31N3O4
and a molecular weight of 449.55 g/mol. Its IUPAC name is [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate.
Molecular Properties
| Compound Name | [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate |
| PubChem CID | 23589368 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate |
| SMILES | CN(C(=O)C1(OC(=O)NCc2ccccc2)CCCCC1)C(C#N)COCc1ccccc1 |
| InChI | InChI=1S/C26H31N3O4/c1-29(23(17-27)20-32-19-22-13-7-3-8-14-22)24(30)26(15-9-4-10-16-26)33-25(31)28-18-21-11-5-2-6-12-21/h2-3,5-8,11-14,23H,4,9-10,15-16,18-20H2,1H3,(H,28,31) |
| InChIKey | GVSCADDVHLZPGD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate?
The IUPAC name of [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate (CID 23589368) is [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate.
What is the SMILES notation for [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate?
The canonical SMILES for [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate is CN(C(=O)C1(OC(=O)NCc2ccccc2)CCCCC1)C(C#N)COCc1ccccc1.
What is the InChIKey of [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate?
The InChIKey is GVSCADDVHLZPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31N3O4/c1-29(23(17-27)20-32-19-22-13-7-3-8-14-22)24(30)26(15-9-4-10-16-26)33-25(31)28-18-21-11-5-2-6-12-21/h2-3,5-8,11-14,23H,4,9-10,15-16,18-20H2,1H3,(H,28,31).
What are the key properties of [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate?
[1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate has a molecular weight of 449.55 g/mol, XLogP of 4.18, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1-cyano-2-phenylmethoxyethyl)-methylcarbamoyl]cyclohexyl] N-benzylcarbamate is sourced from PubChem (CID 23589368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).