C25H21N3O4 — CID 23589724
3-(1-benzofuran-2-yl)-4-methoxy-N-[(3-methoxyphenyl)methyl]-1H-indazole-5-carboxamide (PubChem CID 23589724) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-4-methoxy-N-[(3-methoxyphenyl)methyl]-1H-indazole-5-carboxamide.
| Compound Name | 3-(1-benzofuran-2-yl)-4-methoxy-N-[(3-methoxyphenyl)methyl]-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 23589724 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-4-methoxy-N-[(3-methoxyphenyl)methyl]-1H-indazole-5-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2ccc3[nH]nc(-c4cc5ccccc5o4)c3c2OC)c1 |
| InChI | InChI=1S/C25H21N3O4/c1-30-17-8-5-6-15(12-17)14-26-25(29)18-10-11-19-22(24(18)31-2)23(28-27-19)21-13-16-7-3-4-9-20(16)32-21/h3-13H,14H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | AFQSDBXFYHXVFC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |